EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29NO2 |
| Net Charge | 0 |
| Average Mass | 255.402 |
| Monoisotopic Mass | 255.21983 |
| SMILES | CN(C)C(OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C15H29NO2/c1-16(2)15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14/h13-15H,3-12H2,1-2H3 |
| InChIKey | GCCBITPXNLHRFH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-Dimethylformamide dicyclohexyl acetal (CHEBI:189236) is a organic amino compound (CHEBI:50047) |
| N,N-Dimethylformamide dicyclohexyl acetal (CHEBI:189236) is a organic hydroxy compound (CHEBI:33822) |
| IUPAC Name |
|---|
| 1,1-dicyclohexyloxy-N,N-dimethylmethanamine |