EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16N4O2 |
| Net Charge | 0 |
| Average Mass | 176.220 |
| Monoisotopic Mass | 176.12733 |
| SMILES | CCCN(CCCN)/[N+]([O-])=N/O |
| InChI | InChI=1S/C6H16N4O2/c1-2-5-9(6-3-4-7)10(12)8-11/h11H,2-7H2,1H3/b10-8- |
| InChIKey | QODRTFHTYGHQMT-NTMALXAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PAPA NONOate (CHEBI:189230) is a alkylamine (CHEBI:13759) |
| IUPAC Name |
|---|
| (Z)-[3-aminopropyl(propyl)amino]-hydroxyimino-oxidoazanium |
| Manual Xrefs | Databases |
|---|---|
| 10632351 | ChemSpider |