EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O4 |
| Net Charge | 0 |
| Average Mass | 163.133 |
| Monoisotopic Mass | 163.05931 |
| SMILES | N[C@@H](CNC(=O)NO)C(=O)O |
| InChI | InChI=1S/C4H9N3O4/c5-2(3(8)9)1-6-4(10)7-11/h2,11H,1,5H2,(H,8,9)(H2,6,7,10)/t2-/m0/s1 |
| InChIKey | XAFCEWGVBTWSTN-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-beta-(3-hydroxyureido)-alanine (CHEBI:189225) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(hydroxycarbamoylamino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 166214 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:56073-44-0 | ChemIDplus |