EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H3N2O4S |
| Net Charge | -1 |
| Average Mass | 223.189 |
| Monoisotopic Mass | 222.98190 |
| SMILES | N#CSc1ccc([N+](=O)[O-])c(C(=O)[O-])c1 |
| InChI | InChI=1S/C8H4N2O4S/c9-4-15-5-1-2-7(10(13)14)6(3-5)8(11)12/h1-3H,(H,11,12)/p-1 |
| InChIKey | NQUNIMFHIWQQGJ-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Nitro-5-thiocyanatobenzoate (CHEBI:189220) is a nitrobenzoic acid (CHEBI:25553) |
| IUPAC Name |
|---|
| 2-nitro-5-thiocyanatobenzoate |
| Manual Xrefs | Databases |
|---|---|
| 5383822 | ChemSpider |