EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N6O4 |
| Net Charge | 0 |
| Average Mass | 488.633 |
| Monoisotopic Mass | 488.31110 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](CCCN)N(C(=O)C(Cc2ccccc2)NC(=O)C(N)CCCCN)C1=O |
| InChI | InChI=1S/C25H40N6O4/c1-16(2)21-25(35)31(20(12-8-14-27)23(33)30-21)24(34)19(15-17-9-4-3-5-10-17)29-22(32)18(28)11-6-7-13-26/h3-5,9-10,16,18-21H,6-8,11-15,26-28H2,1-2H3,(H,29,32)(H,30,33)/t18?,19?,20-,21+/m1/s1 |
| InChIKey | NKNBNGMFQVMRAX-VFUGHAIPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo[N-(Lys-Phe)-Orn-Val] (CHEBI:189185) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2,6-diamino-N-[1-[(2R,5S)-2-(3-aminopropyl)-3,6-dioxo-5-propan-2-ylpiperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]hexanamide |
| Manual Xrefs | Databases |
|---|---|
| 78442785 | ChemSpider |