EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O6 |
| Net Charge | 0 |
| Average Mass | 164.113 |
| Monoisotopic Mass | 164.03209 |
| SMILES | O=C(O)C[C@@](O)(CO)C(=O)O |
| InChI | InChI=1S/C5H8O6/c6-2-5(11,4(9)10)1-3(7)8/h6,11H,1-2H2,(H,7,8)(H,9,10)/t5-/m1/s1 |
| InChIKey | QKDVEGVVCQTJPD-RXMQYKEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Itatartaric acid (CHEBI:189177) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-2-(hydroxymethyl)butanedioic acid |