EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N6O8 |
| Net Charge | 0 |
| Average Mass | 384.305 |
| Monoisotopic Mass | 384.10296 |
| SMILES | CCOC(=O)N1CCN(/[N+]([O-])=N/Oc2cc([N+](=O)[O-])ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16N6O8/c1-2-26-13(20)15-5-7-16(8-6-15)19(25)14-27-12-9-10(17(21)22)3-4-11(12)18(23)24/h3-4,9H,2,5-8H2,1H3/b19-14- |
| InChIKey | IEYXVHQWLXJZAG-RGEXLXHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 4-[(Z)-(2,5-dinitrophenoxy)-NNO-azoxy]-1-piperazinecarboxylate (CHEBI:189175) is a piperazinecarboxylic acid (CHEBI:48683) |
| IUPAC Name |
|---|
| (Z)-(2,5-dinitrophenoxy)imino-(4-ethoxycarbonylpiperazin-1-yl)-oxidoazanium |
| Manual Xrefs | Databases |
|---|---|
| 65322601 | ChemSpider |