EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N3O2S |
| Net Charge | 0 |
| Average Mass | 171.181 |
| Monoisotopic Mass | 171.01025 |
| SMILES | Nc1nc(=S)ncc1C(=O)O |
| InChI | InChI=1S/C5H5N3O2S/c6-3-2(4(9)10)1-7-5(11)8-3/h1H,(H,9,10)(H3,6,7,8,11) |
| InChIKey | DRCCUWZDHQOJQA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-2-sulfanylpyrimidine-5-carboxylic acid (CHEBI:189157) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| 6-amino-2-sulanylidene-1H-pyrimidine-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 1461676 | ChemSpider |