EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H43N3O2 |
| Net Charge | 0 |
| Average Mass | 549.759 |
| Monoisotopic Mass | 549.33553 |
| SMILES | C=CCN(CC=C)c1ccccc1[C@H]([C@@H](CC#N)C(=O)OC(C)(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C36H43N3O2/c1-7-25-38(26-8-2)33-22-16-15-21-31(33)34(32(23-24-37)35(40)41-36(4,5)6)39(27-29-17-11-9-12-18-29)28(3)30-19-13-10-14-20-30/h7-22,28,32,34H,1-2,23,25-27H2,3-6H3/t28-,32-,34-/m1/s1 |
| InChIKey | NARGBLIJCBBGPN-KYACCQSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-2-propanyl (2R,3S)-3-{benzyl[(1R)-1-phenylethyl]amino}-2-(cyanomethyl)-3-[2-(diallylamino)phenyl]propanoate (CHEBI:189151) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| tert-butyl (2R,3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[2-[bis(prop-2-enyl)amino]phenyl]-2-(cyanomethyl)propanoate |
| Manual Xrefs | Databases |
|---|---|
| 31092605 | ChemSpider |