EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14F2N2 |
| Net Charge | 0 |
| Average Mass | 284.309 |
| Monoisotopic Mass | 284.11250 |
| SMILES | Fc1ccc(N=CC=CC=CNc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14F2N2/c18-14-4-8-16(9-5-14)20-12-2-1-3-13-21-17-10-6-15(19)7-11-17/h1-13,20H |
| InChIKey | WRTHMRUHGLIQNU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fluoro-N-[5-(4-fluorophenyl)iminopenta-1,3-dienyl]aniline (CHEBI:189135) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-fluoro-N-[5-(4-fluorophenyl)iminopenta-1,3-dienyl]aniline |
| Manual Xrefs | Databases |
|---|---|
| 35218587 | ChemSpider |