EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:189125 - Dibenzylamine
| Formula | C14H15N |
| Net Charge | 0 |
| Average Mass | 197.281 |
| Monoisotopic Mass | 197.12045 |
| SMILES | c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | BWLUMTFWVZZZND-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dibenzylamine (CHEBI:189125) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| N-benzyl-1-phenylmethanamine |