EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CC(O)CCCC=CCC=CCC=CCC=CCCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-19(21)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20(22)23/h3-6,9-12,19,21H,2,7-8,13-18H2,1H3,(H,22,23) |
| InChIKey | XFUXZHQUWPFWPR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | leaf sheath (BTO:0005094) | MetaboLights (MTBLS3518) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19(R)-hete (CHEBI:189102) is a hydroxy fatty acid (CHEBI:24654) |
| 19(R)-hete (CHEBI:189102) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| 19-hydroxyicosa-5,8,11,14-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21236255 | ChemSpider |