EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N7O3 |
| Net Charge | +2 |
| Average Mass | 285.308 |
| Monoisotopic Mass | 285.15384 |
| SMILES | [H][C@@]12NC(=[NH2+])N[C@@]13[C@@H](O)CCN3C(=[NH2+])N[C@H]2COC(N)=O |
| InChI | InChI=1S/C10H17N7O3/c11-7-15-6-4(3-20-9(13)19)14-8(12)17-2-1-5(18)10(6,17)16-7/h4-6,18H,1-3H2,(H2,12,14)(H2,13,19)(H3,11,15,16)/p+2/t4-,5-,6-,10+/m0/s1 |
| InChIKey | NILHUXIFTLLDPJ-AVGUDYQDSA-P |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-saxitoxinol(2+) (CHEBI:189097) is a alkaloid (CHEBI:22315) |
| β-saxitoxinol(2+) (CHEBI:189097) is a guanidines (CHEBI:24436) |
| β-saxitoxinol(2+) (CHEBI:189097) is a iminium ion (CHEBI:35286) |
| β-saxitoxinol(2+) (CHEBI:189097) is a pyrrolopurine (CHEBI:136861) |
| Synonym | Source |
|---|---|
| β-STOH(2+) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| β-saxitoxinol | UniProt |
| Citations |
|---|