EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N4O11P2 |
| Net Charge | -3 |
| Average Mass | 401.141 |
| Monoisotopic Mass | 400.99160 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H14N4O11P2/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(22-8)1-21-25(19,20)23-24(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H,19,20)(H2,16,17,18)/p-3/t3-,4-,5-,8-/m1/s1 |
| InChIKey | HWSPXPQHONXITJ-AFCXAGJDSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin 5'-diphosphate(3−) (CHEBI:189092) is a organophosphate oxoanion (CHEBI:58945) |
| ribavirin 5'-diphosphate(3−) (CHEBI:189092) is conjugate base of ribavirin 5'-diphosphate (CHEBI:180481) |
| Incoming Relation(s) |
| ribavirin 5'-diphosphate (CHEBI:180481) is conjugate acid of ribavirin 5'-diphosphate(3−) (CHEBI:189092) |
| IUPAC Name |
|---|
| 1-{5-O-[(phosphonatooxy)phosphinato]-β-D-ribofuranosyl}-1H-1,2,4-triazole-3-carboxamide |