EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O |
| Net Charge | 0 |
| Average Mass | 358.610 |
| Monoisotopic Mass | 358.32357 |
| SMILES | [H][C@]12C/C=C(\C)[C@@H](O)CC/C(C)=C/CC/C(C)=C/C[C@]1(C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C25H42O/c1-18(2)22-15-17-25(6)16-14-20(4)9-7-8-19(3)10-13-24(26)21(5)11-12-23(22)25/h8,11,14,18,22-24,26H,7,9-10,12-13,15-17H2,1-6H3/b19-8+,20-14+,21-11+/t22-,23+,24-,25+/m0/s1 |
| InChIKey | MGRJONRALKLFBS-YBSCOXHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bipolaris maydis (ncbitaxon:5016) | - | DOI (10.1021/acs.orglett.7b03418) | Strain: BmTS3 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| preterpestacin I (CHEBI:189069) has role fungal metabolite (CHEBI:76946) |
| preterpestacin I (CHEBI:189069) is a carbobicyclic compound (CHEBI:36785) |
| preterpestacin I (CHEBI:189069) is a secondary allylic alcohol (CHEBI:134396) |
| preterpestacin I (CHEBI:189069) is a sesterterpenoid (CHEBI:26660) |
| IUPAC Name |
|---|
| (3S,3aR,5E,7S,10E,14E,16aS)-6,10,14,16a-tetramethyl-3-(propan-2-yl)-1,2,3,3a,4,7,8,9,12,13,16,16a-dodecahydrocyclopenta[15]annulen-7-ol |
| Citations |
|---|