EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34N4O6 |
| Net Charge | -2 |
| Average Mass | 582.657 |
| Monoisotopic Mass | 582.24893 |
| SMILES | [H]C(C)=C1/C(=C/c2nc(/C=C3\N=C(/C=C4\NC(=O)C(C=C)=C4C)C(C)=C3CCC(=O)[O-])c(CCC(=O)[O-])c2C)NC(=O)[C@@H]1C |
| InChI | InChI=1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-15,19,35H,2,9-12H2,1,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/p-2/b20-7?,26-13-,27-14-,28-15-/t19-/m1/s1 |
| InChIKey | DKMLMZVDTGOEGU-MKLOKSPTSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytochromobilin(2−) (CHEBI:189064) is a dicarboxylic acid dianion (CHEBI:28965) |
| phytochromobilin(2−) (CHEBI:189064) is a linear tetrapyrrole anion (CHEBI:59252) |
| phytochromobilin(2−) (CHEBI:189064) is conjugate base of phytochromobilin (CHEBI:26116) |
| Incoming Relation(s) |
| phytochromobilin (CHEBI:26116) is conjugate acid of phytochromobilin(2−) (CHEBI:189064) |
| UniProt Name | Source |
|---|---|
| phytochromobilin | UniProt |