EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N4O6 |
| Net Charge | -2 |
| Average Mass | 588.705 |
| Monoisotopic Mass | 588.29588 |
| SMILES | CCC1=C(C)[C@@H](CC2=N/C(=C\c3nc(C[C@@H]4NC(=O)C(C)=C4CC)c(C)c3CCC(=O)[O-])C(CCC(=O)[O-])=C2C)NC1=O |
| InChI | InChI=1S/C33H42N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h15,26-27,35H,7-14H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/p-2/b28-15-/t26-,27+/m1/s1 |
| InChIKey | KDCCOOGTVSRCHX-YYVBKQGDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S,10Z,16R)-phycourobilin(2−) (CHEBI:189062) is a dicarboxylic acid dianion (CHEBI:28965) |
| (4S,10Z,16R)-phycourobilin(2−) (CHEBI:189062) is a linear tetrapyrrole anion (CHEBI:59252) |
| (4S,10Z,16R)-phycourobilin(2−) (CHEBI:189062) is conjugate base of (4S,10Z,16R)-phycourobilin (CHEBI:45097) |
| Incoming Relation(s) |
| (4S,10Z,16R)-phycourobilin (CHEBI:45097) is conjugate acid of (4S,10Z,16R)-phycourobilin(2−) (CHEBI:189062) |
| UniProt Name | Source |
|---|---|
| phycourobilin | UniProt |