EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O5 |
| Net Charge | 0 |
| Average Mass | 342.391 |
| Monoisotopic Mass | 342.14672 |
| SMILES | COc1cc(CCC(=O)CC(=O)CCc2cccc(O)c2)ccc1O |
| InChI | InChI=1S/C20H22O5/c1-25-20-12-15(7-10-19(20)24)6-9-18(23)13-17(22)8-5-14-3-2-4-16(21)11-14/h2-4,7,10-12,21,24H,5-6,8-9,13H2,1H3 |
| InChIKey | LALFLVYIAIOVIR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles sinensis (ncbitaxon:74873) | Whole Organism (NCIT:C13413) | Article |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-hydroxy-3-methoxyphenyl)-7-(3-hydroxyphenyl)heptane-3,5-dione (CHEBI:189045) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-7-(3-hydroxyphenyl)heptane-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 74853339 | ChemSpider |
| HMDB0133499 | HMDB |