EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | CCCCCCCC[C@H](O)/C=C/C=C\C=C\[C@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h7-8,10-11,14-15,18-19,21-22H,2-6,9,12-13,16-17H2,1H3,(H,23,24)/b8-7-,14-10+,15-11+/t18-,19-/m0/s1 |
| InChIKey | NGTXCORNXNELNU-BOIFFFMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles sinensis (ncbitaxon:74873) | Whole Organism (NCIT:C13413) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LTB3 (CHEBI:189035) is a hydroxy fatty acid (CHEBI:24654) |
| LTB3 (CHEBI:189035) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| (5R,6E,8Z,10E,12S)-5,12-dihydroxyicosa-6,8,10-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4943879 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:88099-35-8 | ChemIDplus |