EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O12 |
| Net Charge | 0 |
| Average Mass | 472.443 |
| Monoisotopic Mass | 472.15808 |
| SMILES | COc1cc(/C=C/C(=O)OCC2OC(OC3C(O)COC(O)C3O)C(OC)C2O)ccc1O |
| InChI | InChI=1S/C21H28O12/c1-28-13-7-10(3-5-11(13)22)4-6-15(24)30-9-14-16(25)19(29-2)21(32-14)33-18-12(23)8-31-20(27)17(18)26/h3-7,12,14,16-23,25-27H,8-9H2,1-2H3/b6-4+ |
| InChIKey | YGNHGXTZNFXTBH-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles sinensis (ncbitaxon:74873) | Whole Organism (NCIT:C13413) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-((Z)-Feruloyl) 3-(2'-methylarabinosylxylose) (CHEBI:189032) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [3-hydroxy-4-methoxy-5-(2,3,5-trihydroxyoxan-4-yl)oxyoxolan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030231 | HMDB |