EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O5 |
| Net Charge | 0 |
| Average Mass | 284.272 |
| Monoisotopic Mass | 284.11207 |
| SMILES | NC(CCC(=O)O)C(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C11H16N4O5/c12-7(1-2-9(16)17)10(18)15-8(11(19)20)3-6-4-13-5-14-6/h4-5,7-8H,1-3,12H2,(H,13,14)(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | HKTRDWYCAUTRRL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles sinensis (ncbitaxon:74873) | Whole Organism (NCIT:C13413) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glutamylhistidine (CHEBI:189026) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 4-amino-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8036305 | ChemSpider |