EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC#CCCCC(=O)O |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12- |
| InChIKey | GIOQWSLKUVKKAO-QNEBEIHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles sinensis (ncbitaxon:74873) | Whole Organism (NCIT:C13413) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dehydro Arachidonic Acid (CHEBI:189012) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (8Z,11Z,14Z)-icosa-8,11,14-trien-5-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4947777 | ChemSpider |
| LMFA01030695 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:58688-54-3 | ChemIDplus |