EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N4O10S |
| Net Charge | 0 |
| Average Mass | 502.502 |
| Monoisotopic Mass | 502.13696 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSc1cc(C[C@H](N)C(=O)O)cc(O)c1O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26N4O10S/c20-9(18(30)31)1-2-14(25)23-11(17(29)22-6-15(26)27)7-34-13-5-8(3-10(21)19(32)33)4-12(24)16(13)28/h4-5,9-11,24,28H,1-3,6-7,20-21H2,(H,22,29)(H,23,25)(H,26,27)(H,30,31)(H,32,33)/t9-,10-,11-/m0/s1 |
| InChIKey | QPUCCRKMCAEIND-DCAQKATOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles sinensis (ncbitaxon:74873) | Whole Organism (NCIT:C13413) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-S-glutathionyl-L-DOPA (CHEBI:189009) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(2R)-3-[5-[(2S)-2-amino-2-carboxyethyl]-2,3-dihydroxyphenyl]sulanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0062425 | HMDB |
| 8966885 | ChemSpider |