EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | Cc1c(C)c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C10H14O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H,1-4H3 |
| InChIKey | SUNVJLYYDZCIIK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spinacia oleracea (ncbitaxon:3562) | leaf (BTO:0000713) | DOI (10.1111/jfs.12891) | |
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (11731089) | Strain: HH35 |
| Roles Classification |
|---|
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| durohydroquinone (CHEBI:189006) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| durohydroquinone (CHEBI:189006) has role volatile oil component (CHEBI:27311) |
| durohydroquinone (CHEBI:189006) is a hydroquinones (CHEBI:24646) |
| durohydroquinone (CHEBI:189006) is a methylbenzene (CHEBI:38975) |
| IUPAC Name |
|---|
| 2,3,5,6-tetramethylbenzene-1,4-diol |
| Synonyms | Source |
|---|---|
| tetramethyl-1,4-benzoquinol | SUBMITTER |
| tetramethyl-p-benzoquinol | SUBMITTER |
| durohydroquinone | ChemIDplus |
| tetramethylbenzene-1,4-diol | SUBMITTER |
| dihydroxydurene | NIST Chemistry WebBook |
| 2,3,5,6-tetramethylhydroquinone | ChEBI |
| UniProt Name | Source |
|---|---|
| duroquinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0251643 | HMDB |
| CPD-23347 | MetaCyc |
| 120120 | ChemSpider |
| Citations |
|---|