EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O4 |
| Net Charge | 0 |
| Average Mass | 434.661 |
| Monoisotopic Mass | 434.33961 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)[C@H](O)CC(C)C |
| InChI | InChI=1S/C27H46O4/c1-15(2)12-24(30)25(31)16(3)19-6-7-20-18-14-23(29)22-13-17(28)8-10-27(22,5)21(18)9-11-26(19,20)4/h15-22,24-25,28,30-31H,6-14H2,1-5H3/t16-,17-,18-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1 |
| InChIKey | LEHNWZXASREXJG-ODJNXLQUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | - | PubMed (35163750) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 28-norteasterone (CHEBI:188988) has role plant metabolite (CHEBI:76924) |
| 28-norteasterone (CHEBI:188988) is a 22-hydroxy steroid (CHEBI:36863) |
| 28-norteasterone (CHEBI:188988) is a 23-hydroxy steroid (CHEBI:36866) |
| 28-norteasterone (CHEBI:188988) is a 3β-hydroxy steroid (CHEBI:36836) |
| 28-norteasterone (CHEBI:188988) is a 6-oxo steroid (CHEBI:36883) |
| 28-norteasterone (CHEBI:188988) is a a C27-steroid (CHEBI:188919) |
| 28-norteasterone (CHEBI:188988) is a brassinosteroid (CHEBI:22921) |
| IUPAC Name |
|---|
| (22R,23R)-3β,22,23-trihydroxy-5α-cholestan-6-one |
| Synonyms | Source |
|---|---|
| 28-norTE | MetaCyc |
| (3β,5α,22R,23R)-3,22,23-trihydroxy-cholestan-6-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 28-norteasterone | UniProt |
| Citations |
|---|