EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N |
| Net Charge | 0 |
| Average Mass | 149.237 |
| Monoisotopic Mass | 149.12045 |
| SMILES | CN(C)CCc1ccccc1 |
| InChI | InChI=1S/C10H15N/c1-11(2)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | TXOFSCODFRHERQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus Aureus (ncbitaxon:1280) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3859) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-Dimethylphenethylamine (CHEBI:188983) is a primary amine (CHEBI:32877) |
| IUPAC Name |
|---|
| N,N-dimethyl-2-phenylethanamine |