EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O4 |
| Net Charge | 0 |
| Average Mass | 244.291 |
| Monoisotopic Mass | 244.14231 |
| SMILES | CC(C)C[C@H](N)C(=O)N1C[C@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C11H20N2O4/c1-6(2)3-8(12)10(15)13-5-7(14)4-9(13)11(16)17/h6-9,14H,3-5,12H2,1-2H3,(H,16,17)/t7-,8+,9+/m1/s1 |
| InChIKey | JCCZCUUYYHWRGX-VGMNWLOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus Aureus (ncbitaxon:1280) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3859) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leucyl-Hydroxyproline (CHEBI:188969) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,4R)-1-[(2S)-2-amino-4-methylpentanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 25050183 | ChemSpider |