EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15NO4 |
| Net Charge | 0 |
| Average Mass | 321.332 |
| Monoisotopic Mass | 321.10011 |
| SMILES | COc1cc2c3c(cc4ccccc4c3c1OC)N(C)C(=O)C2=O |
| InChI | InChI=1S/C19H15NO4/c1-20-13-8-10-6-4-5-7-11(10)16-15(13)12(17(21)19(20)22)9-14(23-2)18(16)24-3/h4-9H,1-3H3 |
| InChIKey | AFKGBLKLNRDQFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus Aureus (ncbitaxon:1280) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3859) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cepharadione B (CHEBI:188963) has functional parent aporphine (CHEBI:35643) |
| Cepharadione B (CHEBI:188963) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-11,12-dione |
| Manual Xrefs | Databases |
|---|---|
| 164349 | ChemSpider |
| HMDB0030391 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:55610-02-1 | ChemIDplus |