EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O3 |
| Net Charge | 0 |
| Average Mass | 102.089 |
| Monoisotopic Mass | 102.03169 |
| SMILES | CC=C(O)C(=O)O |
| InChI | InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2,5H,1H3,(H,6,7) |
| InChIKey | RTWLEDIMOQVWDF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumis sativus (ncbitaxon:3659) | leaf (BTO:0000713) | MetaboLights (MTBLS3923) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-2-butenoic acid (CHEBI:188959) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| 2-hydroxybut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57539211 | ChemSpider |