EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | COc1cc(/C=C/C(=O)O)c(O)cc1O |
| InChI | InChI=1S/C10H10O5/c1-15-9-4-6(2-3-10(13)14)7(11)5-8(9)12/h2-5,11-12H,1H3,(H,13,14)/b3-2+ |
| InChIKey | QVTORZSLDIMFQS-NSCUHMNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus Aureus (ncbitaxon:1280) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3859) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-3-(2,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid (CHEBI:188953) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(2,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24784650 | ChemSpider |
| HMDB0125514 | HMDB |