EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO |
| Net Charge | 0 |
| Average Mass | 185.226 |
| Monoisotopic Mass | 185.08406 |
| SMILES | Oc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO/c14-12-8-4-7-11(9-12)13-10-5-2-1-3-6-10/h1-9,13-14H |
| InChIKey | NDACNGSDAFKTGE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus Aureus (ncbitaxon:1280) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3859) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxydiphenylamine (CHEBI:188941) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-anilinophenol |