EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N5OS |
| Net Charge | 0 |
| Average Mass | 243.336 |
| Monoisotopic Mass | 243.11538 |
| SMILES | CCNc1nc(NC(C)C)nc(S(C)=O)n1 |
| InChI | InChI=1S/C9H17N5OS/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)16(4)15/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
| InChIKey | LKFFHIOAQPRPCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Ethyl-N'-isopropyl-6-(methylsulfinyl)-1,3,5-triazine-2,4-diamine (CHEBI:188905) is a diamino-1,3,5-triazine (CHEBI:38170) |
| IUPAC Name |
|---|
| 4-N-ethyl-6-methylsulinyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| Manual Xrefs | Databases |
|---|---|
| 138737 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:80525-15-1 | ChemIDplus |