EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8ClNO |
| Net Charge | 0 |
| Average Mass | 157.600 |
| Monoisotopic Mass | 157.02944 |
| SMILES | COc1cc(N)ccc1Cl |
| InChI | InChI=1S/C7H8ClNO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,9H2,1H3 |
| InChIKey | LNKBDFVSILQKSI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Chloro-3-methoxyaniline (CHEBI:188903) is a aromatic ether (CHEBI:35618) |
| 4-Chloro-3-methoxyaniline (CHEBI:188903) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-chloro-3-methoxyaniline |
| Manual Xrefs | Databases |
|---|---|
| 10629121 | ChemSpider |