EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N3O |
| Net Charge | 0 |
| Average Mass | 331.419 |
| Monoisotopic Mass | 331.16846 |
| SMILES | CN(C)[C@@H](Cc1ccccc1)c1ncc(-c2cnc3ccccc23)o1 |
| InChI | InChI=1S/C21H21N3O/c1-24(2)19(12-15-8-4-3-5-9-15)21-23-14-20(25-21)17-13-22-18-11-7-6-10-16(17)18/h3-11,13-14,19,22H,12H2,1-2H3/t19-/m0/s1 |
| InChIKey | GAAGMSPHTNSDSL-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| almazole C (CHEBI:188901) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (1S)-1-[5-(1H-indol-3-yl)-1,3-oxazol-2-yl]-N,N-dimethyl-2-phenylethanamine |
| Manual Xrefs | Databases |
|---|---|
| 9231808 | ChemSpider |