EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26N2O4 |
| Net Charge | 0 |
| Average Mass | 298.383 |
| Monoisotopic Mass | 298.18926 |
| SMILES | N[C@@H](CCCCNC(=O)OC1CC/C=C\CCC1)C(=O)O |
| InChI | InChI=1S/C15H26N2O4/c16-13(14(18)19)10-6-7-11-17-15(20)21-12-8-4-2-1-3-5-9-12/h1-2,12-13H,3-11,16H2,(H,17,20)(H,18,19)/b2-1-/t12?,13-/m0/s1 |
| InChIKey | FOGYUVXBYCZPFK-RSZBLZTFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-{[(4E)-4-Cycloocten-1-yloxy]carbonyl}lysine (CHEBI:188888) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28475319 | ChemSpider |