EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44O7 |
| Net Charge | 0 |
| Average Mass | 588.741 |
| Monoisotopic Mass | 588.30870 |
| SMILES | [H][C@]1([C@@H](C)CCC=C(C)C)C[C@H](Oc2ccc(/C=C/C(O)=C/C(=O)/C=C/c3ccc(O)c(OC)c3)cc2OC)C(C)=C[C@@H]1O |
| InChI | InChI=1S/C36H44O7/c1-23(2)8-7-9-24(3)30-22-34(25(4)18-32(30)40)43-33-17-13-27(20-36(33)42-6)11-15-29(38)21-28(37)14-10-26-12-16-31(39)35(19-26)41-5/h8,10-21,24,30,32,34,38-40H,7,9,22H2,1-6H3/b14-10+,15-11+,29-21-/t24-,30+,32-,34-/m0/s1 |
| InChIKey | WLFPRMQOFUMWBP-WXJREWSDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terpecurcumin B (CHEBI:188860) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,4Z,6E)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-[4-[(1S,4R,5R)-4-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-yl]oxy-3-methoxyphenyl]hepta-1,4,6-trien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 28536061 | ChemSpider |