EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO4S |
| Net Charge | 0 |
| Average Mass | 329.462 |
| Monoisotopic Mass | 329.16608 |
| SMILES | C[C@H](CSC(=O)C(C)(C)C)C(=O)N(CC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C16H27NO4S/c1-11(10-22-15(21)16(2,3)4)14(20)17(9-13(18)19)12-7-5-6-8-12/h11-12H,5-10H2,1-4H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | XRKXJJYSKUIIEN-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pivopril (CHEBI:188840) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[cyclopentyl-[(2S)-3-(2,2-dimethylpropanoylsulanyl)-2-methylpropanoyl]amino]acetic acid |
| INN | Source |
|---|---|
| pivopril | WHO MedNet |
| Synonyms | Source |
|---|---|
| REV 3569-(S) | ChEMBL |
| REV 3659-(S) | ChEMBL |
| REV-3659 (S) | ChEMBL |
| REV-3659-(S) | ChEMBL |
| RHC 3659-(S) | ChEMBL |
| RHC-3659 (S) | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:81045-50-3 | ChemIDplus |
| Citations |
|---|