EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N3O6 |
| Net Charge | 0 |
| Average Mass | 327.337 |
| Monoisotopic Mass | 327.14304 |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21N3O6/c1-9(18)15-8-4-3-5-11(16-10(2)19)14(22)23-17-12(20)6-7-13(17)21/h11H,3-8H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | LATUYRINCRWMKQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dioxopyrrolidin-1-yl N2,N6-diacetyllysinate (CHEBI:188839) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate |
| Manual Xrefs | Databases |
|---|---|
| 65324470 | ChemSpider |