EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N3O6 |
| Net Charge | 0 |
| Average Mass | 365.386 |
| Monoisotopic Mass | 365.15869 |
| SMILES | N[C@@H](C[C@@H](CCCC(=O)NCC(=O)Nc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23N3O6/c18-13(17(25)26)9-11(16(23)24)5-4-8-14(21)19-10-15(22)20-12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10,18H2,(H,19,21)(H,20,22)(H,23,24)(H,25,26)/t11-,13+/m1/s1 |
| InChIKey | XKVOHIXGSHTPCI-YPMHNXCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-4-{4-[(2-Anilino-2-oxoethyl)amino]-4-oxobutyl}-L-glutamic acid (CHEBI:188836) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S,4R)-2-amino-4-[4-[(2-anilino-2-oxoethyl)amino]-4-oxobutyl]pentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 4449785 | ChemSpider |