EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4S |
| Net Charge | 0 |
| Average Mass | 176.193 |
| Monoisotopic Mass | 176.01433 |
| SMILES | CCS/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O4S/c1-2-11-4(6(9)10)3-5(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10)/b4-3- |
| InChIKey | IKOFDMGPFDDETP-ARJAWSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z)-2-(Ethylsulfanyl)-2-butenedioic acid (CHEBI:188833) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (Z)-2-ethylsulanylbut-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 65326631 | ChemSpider |