EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37NOSn |
| Net Charge | 0 |
| Average Mass | 426.233 |
| Monoisotopic Mass | 427.18971 |
| SMILES | CCC[CH2][Sn]([CH2]CCC)([CH2]CCC)[CH2]Oc1ccccc1CN |
| InChI | InChI=1S/C8H10NO.3C4H9.Sn/c1-10-8-5-3-2-4-7(8)6-9;3*1-3-4-2;/h2-5H,1,6,9H2;3*1,3-4H2,2H3; |
| InChIKey | KEZZUDLZTZKAQO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-((Tributylstannyl)methoxy)phenyl)methanamine (CHEBI:188829) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| [2-(tributylstannylmethoxy)phenyl]methanamine |