EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24O5 |
| Net Charge | 0 |
| Average Mass | 272.341 |
| Monoisotopic Mass | 272.16237 |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)C(=O)CC(C)C |
| InChI | InChI=1S/C14H24O5/c1-6-18-13(16)12(14(17)19-7-2)10(5)11(15)8-9(3)4/h9-10,12H,6-8H2,1-5H3 |
| InChIKey | PADPRTXRVKVJEZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diethyl (5-methyl-3-oxo-2-hexanyl)malonate (CHEBI:188828) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| diethyl 2-(5-methyl-3-oxohexan-2-yl)propanedioate |
| Manual Xrefs | Databases |
|---|---|
| 24603677 | ChemSpider |