EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H43NO5 |
| Net Charge | 0 |
| Average Mass | 473.654 |
| Monoisotopic Mass | 473.31412 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2CC[C@H](CCCCCCCCCCC(C)=O)N[C@@H]2C)ccc1O |
| InChI | InChI=1S/C28H43NO5/c1-21(30)12-10-8-6-4-5-7-9-11-13-24-16-18-26(22(2)29-24)34-28(32)19-15-23-14-17-25(31)27(20-23)33-3/h14-15,17,19-20,22,24,26,29,31H,4-13,16,18H2,1-3H3/b19-15+/t22-,24+,26-/m1/s1 |
| InChIKey | STSLNURRVKPSHZ-VQQILSIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-3-O-feruloylcassine (CHEBI:188824) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(2R,3R,6S)-2-methyl-6-(11-oxododecyl)piperidin-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 23311513 | ChemSpider |