EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N2O5 |
| Net Charge | 0 |
| Average Mass | 466.578 |
| Monoisotopic Mass | 466.24677 |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| InChI | InChI=1S/C27H34N2O5/c1-16(2)14-23(26(31)33-5)28-25(30)24(17(3)4)29-27(32)34-15-22-20-12-8-6-10-18(20)19-11-7-9-13-21(19)22/h6-13,16-17,22-24H,14-15H2,1-5H3,(H,28,30)(H,29,32)/t23-,24-/m0/s1 |
| InChIKey | OHQUVDKQWKRCQK-ZEQRLZLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]valylleucinate (CHEBI:188807) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2S)-2-(9H-luoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-4-methylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 24747105 | ChemSpider |