EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H39NO5 |
| Net Charge | 0 |
| Average Mass | 505.655 |
| Monoisotopic Mass | 505.28282 |
| SMILES | [H][C@@]12CC[C@](OC(C)=O)(C(=O)COC)[C@@]1(C)C[C@H](c1ccc(N(C)C)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C31H39NO5/c1-19(33)37-31(28(35)18-36-5)15-14-27-25-12-8-21-16-23(34)11-13-24(21)29(25)26(17-30(27,31)2)20-6-9-22(10-7-20)32(3)4/h6-7,9-10,16,25-27H,8,11-15,17-18H2,1-5H3/t25-,26+,27-,30-,31-/m0/s1 |
| InChIKey | JVBGZFRPTRKSBB-MJBQOYBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Telapristone acetate (CHEBI:188804) has role antineoplastic agent (CHEBI:35610) |
| Telapristone acetate (CHEBI:188804) has role renoprotective agent (CHEBI:231911) |
| Telapristone acetate (CHEBI:188804) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| [(8S,11R,13S,14S,17R)-11-[4-(dimethylamino)phenyl]-17-(2-methoxyacetyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| Synonyms | Source |
|---|---|
| CDB-4124 | ChEMBL |
| RU 44675 | ChEMBL |
| RU-44675 | ChEMBL |
| Telapristone acetate | ChEMBL |
| ZPV-200 | ChEMBL |
| Brand Names | Source |
|---|---|
| Proellex | ChEMBL |
| Proellextm | ChEMBL |
| Progenta | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:198414-31-2 | ChemIDplus |