EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14O4 |
| Net Charge | 0 |
| Average Mass | 342.350 |
| Monoisotopic Mass | 342.08921 |
| SMILES | O=C(O)c1ccc2ccccc2c1-c1c(C(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C22H14O4/c23-21(24)17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22(25)26/h1-12H,(H,23,24)(H,25,26) |
| InChIKey | YDZNRNHKJQTGCG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1'-binaphthyl-2,2'-dicarboxylic acid (CHEBI:188801) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 1-(2-carboxynaphthalen-1-yl)naphthalene-2-carboxylic acid |