EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H24O2 |
| Net Charge | 0 |
| Average Mass | 440.542 |
| Monoisotopic Mass | 440.17763 |
| SMILES | COc1ccc2ccccc2c1-c1c(OCc2ccccc2)ccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C32H24O2/c1-33-29-19-16-24-12-6-8-14-26(24)31(29)32-28-17-15-23-11-5-7-13-25(23)27(28)18-20-30(32)34-21-22-9-3-2-4-10-22/h2-20H,21H2,1H3 |
| InChIKey | XSKXTEUIUAXHLX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(Benzyloxy)-1-(2-methoxy-1-naphthyl)phenanthrene (CHEBI:188799) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 1-(2-methoxynaphthalen-1-yl)-2-phenylmethoxyphenanthrene |
| Manual Xrefs | Databases |
|---|---|
| 65326444 | ChemSpider |