EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O2 |
| Net Charge | 0 |
| Average Mass | 184.239 |
| Monoisotopic Mass | 184.12118 |
| SMILES | O=C(C1CCCO1)N1CCNCC1 |
| InChI | InChI=1S/C9H16N2O2/c12-9(8-2-1-7-13-8)11-5-3-10-4-6-11/h8,10H,1-7H2 |
| InChIKey | UKESBLFBQANJHH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(Tetrahydro-2-furoyl)piperazine (CHEBI:188788) is a phytanoyl-CoAs (CHEBI:26114) |
| IUPAC Name |
|---|
| oxolan-2-yl(piperazin-1-yl)methanone |
| Manual Xrefs | Databases |
|---|---|
| 2016385 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:63074-07-7 | ChemIDplus |