EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N6O2 |
| Net Charge | 0 |
| Average Mass | 240.267 |
| Monoisotopic Mass | 240.13347 |
| SMILES | [H][C@@]12N=C(N)N[C@@]13[C@H](O)CCN3C(N)=N[C@H]2CO |
| InChI | InChI=1S/C9H16N6O2/c10-7-13-6-4(3-16)12-8(11)15-2-1-5(17)9(6,15)14-7/h4-6,16-17H,1-3H2,(H2,11,12)(H3,10,13,14)/t4-,5+,6-,9+/m0/s1 |
| InChIKey | AIOWIOMRQZYDEM-SOVPELCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Decarbamoyl-alpha-saxitoxinol (CHEBI:188785) has role marine metabolite (CHEBI:76507) |
| Decarbamoyl-alpha-saxitoxinol (CHEBI:188785) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3aS,4R,10R,10aS)-2,6-diamino-4-(hydroxymethyl)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-10-ol |
| Manual Xrefs | Databases |
|---|---|
| 44210976 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:75352-31-7 | ChemIDplus |