EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2S |
| Net Charge | 0 |
| Average Mass | 278.465 |
| Monoisotopic Mass | 278.18167 |
| SMILES | CC(C)N(C(C)C)C(CCCCC#N)c1ccsc1 |
| InChI | InChI=1S/C16H26N2S/c1-13(2)18(14(3)4)16(8-6-5-7-10-17)15-9-11-19-12-15/h9,11-14,16H,5-8H2,1-4H3 |
| InChIKey | BXDDDCYILUNNRV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(Diisopropylamino)-6-(3-thienyl)hexanenitrile (CHEBI:188780) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 6-[di(propan-2-yl)amino]-6-thiophen-3-ylhexanenitrile |
| Manual Xrefs | Databases |
|---|---|
| 32779452 | ChemSpider |